Products 121034-76-2

CAS 121034-76-2 is the registry number for Ketorolac Impurity 24. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

(5-chloro-1H-pyrrol-3-yl)-phenylmethanone (CAS 121034-76-2) is a chemical compound with the molecular formula C11H8ClNO and a molecular weight of 205.64 g/mol. IUPAC name: (5-chloro-1H-pyrrol-3-yl)-phenylmethanone. InChIKey: LMIRBYBSJPHPHX-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8ClNO
Molecular weight205.64 g/mol
IUPAC name(5-chloro-1H-pyrrol-3-yl)-phenylmethanone
InChIKeyLMIRBYBSJPHPHX-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(=O)C2=CNC(=C2)Cl

Computed by PubChem (NCBI)