CAS 1210378-97-4 appears in our catalog under these names: 5-Amino-4-bromo-7-nitro-1,1,3,3,6-pentamethylindane, 95%, 4-Bromo-1,1,3,3,6-pentamethyl-7-nitro-2,3-dihydro-1H-inden-5-amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
4-bromo-1,1,3,3,6-pentamethyl-7-nitro-2H-inden-5-amine (CAS 1210378-97-4) is a chemical compound with the molecular formula C14H19BrN2O2 and a molecular weight of 327.22 g/mol. IUPAC name: 4-bromo-1,1,3,3,6-pentamethyl-7-nitro-2H-inden-5-amine. InChIKey: SKYWTKZIVUVSRF-UHFFFAOYSA-N.
| Molecular formula | C14H19BrN2O2 |
|---|---|
| Molecular weight | 327.22 g/mol |
| IUPAC name | 4-bromo-1,1,3,3,6-pentamethyl-7-nitro-2H-inden-5-amine |
| InChIKey | SKYWTKZIVUVSRF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C2C(=C1[N+](=O)[O-])C(CC2(C)C)(C)C)Br)N |
Computed by PubChem (NCBI)