CAS 886364-30-3 is the registry number for 4-Boc-7-bromo-2,3,4,5-tetrahydro-1h-benzo[e][1,4]diazepine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl 7-bromo-1,2,3,5-tetrahydro-1,4-benzodiazepine-4-carboxylate (CAS 886364-30-3) is a chemical compound with the molecular formula C14H19BrN2O2 and a molecular weight of 327.22 g/mol. IUPAC name: tert-butyl 7-bromo-1,2,3,5-tetrahydro-1,4-benzodiazepine-4-carboxylate. InChIKey: XTVVPYZXTUZWFG-UHFFFAOYSA-N.
| Molecular formula | C14H19BrN2O2 |
|---|---|
| Molecular weight | 327.22 g/mol |
| IUPAC name | tert-butyl 7-bromo-1,2,3,5-tetrahydro-1,4-benzodiazepine-4-carboxylate |
| InChIKey | XTVVPYZXTUZWFG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC2=C(C1)C=C(C=C2)Br |
Computed by PubChem (NCBI)