Products 2270909-14-1

CAS 2270909-14-1 is the registry number for 3-[4-(4-Bromo-phenyl)-piperazin-1-yl]-propionic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 3-[4-(4-bromophenyl)piperazin-1-yl]propanoate (CAS 2270909-14-1) is a chemical compound with the molecular formula C14H19BrN2O2 and a molecular weight of 327.22 g/mol. IUPAC name: methyl 3-[4-(4-bromophenyl)piperazin-1-yl]propanoate. InChIKey: OTALCMIOIGVTLR-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19BrN2O2
Molecular weight327.22 g/mol
IUPAC namemethyl 3-[4-(4-bromophenyl)piperazin-1-yl]propanoate
InChIKeyOTALCMIOIGVTLR-UHFFFAOYSA-N
SMILESCOC(=O)CCN1CCN(CC1)C2=CC=C(C=C2)Br

Computed by PubChem (NCBI)