CAS 1210418-42-0 is the registry number for rel-(1S,5S)-3-(3-Nitropyridin-4-yl)-5-(trifluoromethyl)cyclohex-2-en-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,5S)-3-(3-nitro-4-pyridinyl)-5-(trifluoromethyl)cyclohex-2-en-1-ol (CAS 1210418-42-0) is a chemical compound with the molecular formula C12H11F3N2O3 and a molecular weight of 288.22 g/mol. IUPAC name: (1S,5S)-3-(3-nitro-4-pyridinyl)-5-(trifluoromethyl)cyclohex-2-en-1-ol. InChIKey: RUCWSEKTDIZSKH-DTWKUNHWSA-N.
| Molecular formula | C12H11F3N2O3 |
|---|---|
| Molecular weight | 288.22 g/mol |
| IUPAC name | (1S,5S)-3-(3-nitro-4-pyridinyl)-5-(trifluoromethyl)cyclohex-2-en-1-ol |
| InChIKey | RUCWSEKTDIZSKH-DTWKUNHWSA-N |
| SMILES | C1[C@H](CC(=C[C@H]1O)C2=C(C=NC=C2)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)