CAS 956907-63-4 is the registry number for N-(2-Oxopropyl)-n'-[3-(trifluoromethyl)-phenyl]ethanediamide, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
N-(2-oxopropyl)-N'-[3-(trifluoromethyl)phenyl]oxamide (CAS 956907-63-4) is a chemical compound with the molecular formula C12H11F3N2O3 and a molecular weight of 288.22 g/mol. IUPAC name: N-(2-oxopropyl)-N'-[3-(trifluoromethyl)phenyl]oxamide. InChIKey: OFJAQCHDDZBYFD-UHFFFAOYSA-N.
| Molecular formula | C12H11F3N2O3 |
|---|---|
| Molecular weight | 288.22 g/mol |
| IUPAC name | N-(2-oxopropyl)-N'-[3-(trifluoromethyl)phenyl]oxamide |
| InChIKey | OFJAQCHDDZBYFD-UHFFFAOYSA-N |
| SMILES | CC(=O)CNC(=O)C(=O)NC1=CC=CC(=C1)C(F)(F)F |
Computed by PubChem (NCBI)