Products 1210419-49-0
CAS 1210419-49-0 is the registry number for 6-(2,6-Difluoro-3-methylphenyl)-5-fluoropicolinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(2,6-difluoro-3-methylphenyl)-5-fluoropyridine-2-carboxylic acid (CAS 1210419-49-0) is a chemical compound with the molecular formula C13H8F3NO2 and a molecular weight of 267.20 g/mol. IUPAC name: 6-(2,6-difluoro-3-methylphenyl)-5-fluoropyridine-2-carboxylic acid. InChIKey: XUGKKUWUQBZDCJ-UHFFFAOYSA-N.
| Molecular formula | C13H8F3NO2 |
|---|---|
| Molecular weight | 267.20 g/mol |
| IUPAC name | 6-(2,6-difluoro-3-methylphenyl)-5-fluoropyridine-2-carboxylic acid |
| InChIKey | XUGKKUWUQBZDCJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)F)C2=C(C=CC(=N2)C(=O)O)F)F |
Computed by PubChem (NCBI)