CAS 121055-08-1 is the registry number for (1S,2R,4R)-Bicyclo(2.2.1)heptan-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
(1S,2R,4R)-bicyclo[2.2.1]heptan-2-amine;hydrochloride (CAS 121055-08-1) is a chemical compound with the molecular formula C7H14ClN and a molecular weight of 147.64 g/mol. IUPAC name: (1S,2R,4R)-bicyclo[2.2.1]heptan-2-amine;hydrochloride. InChIKey: IZZMPZQAQTXAHW-FNCXLRSCSA-N.
| Molecular formula | C7H14ClN |
|---|---|
| Molecular weight | 147.64 g/mol |
| IUPAC name | (1S,2R,4R)-bicyclo[2.2.1]heptan-2-amine;hydrochloride |
| InChIKey | IZZMPZQAQTXAHW-FNCXLRSCSA-N |
| SMILES | C1C[C@H]2C[C@@H]1C[C@H]2N.Cl |
Computed by PubChem (NCBI)