CAS 39245-79-9 appears in our catalog under these names: exo–Bicyclo(2·2·1)heptan–2–amine hydrochloride, exo-Bicyclo[2.2.1]heptan-2-amine hydrochloride 97%, Bicyclo[2.2.1]heptan-2-amine, hydrochloride (1:1), (1R,2R,4S)-rel-, 95%, 95%, exo-Bicyclo[2.2.1]heptan-2-amine hydrochloride, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g, 25g.
(1S,2S,4R)-bicyclo[2.2.1]heptan-2-amine;hydrochloride (CAS 39245-79-9) is a chemical compound with the molecular formula C7H14ClN and a molecular weight of 147.64 g/mol. IUPAC name: (1S,2S,4R)-bicyclo[2.2.1]heptan-2-amine;hydrochloride. InChIKey: IZZMPZQAQTXAHW-NLRFIBDTSA-N.
| Molecular formula | C7H14ClN |
|---|---|
| Molecular weight | 147.64 g/mol |
| IUPAC name | (1S,2S,4R)-bicyclo[2.2.1]heptan-2-amine;hydrochloride |
| InChIKey | IZZMPZQAQTXAHW-NLRFIBDTSA-N |
| SMILES | C1C[C@H]2C[C@@H]1C[C@@H]2N.Cl |
Computed by PubChem (NCBI)