CAS 1210774-95-0 appears in our catalog under these names: Methyl 1,1-dioxo-3-phenyl-4H-1,2,4-benzothiadiazine-7-carboxylate, 95%, Methyl 1,1-dioxo-3-phenyl-4H-1,2,4-benzothiadiazine-7-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
Methyl 1,1-dioxo-3-phenyl-4H-1lambda6,2,4-benzothiadiazine-7-carboxylate (CAS 1210774-95-0) is a chemical compound with the molecular formula C15H12N2O4S and a molecular weight of 316.3 g/mol. IUPAC name: methyl 1,1-dioxo-3-phenyl-4H-1lambda6,2,4-benzothiadiazine-7-carboxylate. InChIKey: ULEGGQRVYXLWRT-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O4S |
|---|---|
| Molecular weight | 316.3 g/mol |
| IUPAC name | methyl 1,1-dioxo-3-phenyl-4H-1lambda6,2,4-benzothiadiazine-7-carboxylate |
| InChIKey | ULEGGQRVYXLWRT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)NC(=NS2(=O)=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)