Products 40467-23-0
CAS 40467-23-0 is the registry number for 3-Phenacyl-1H-2,1,3-benzothiadiazin-4(3H)-one 2,2-dioxide. Offered by: TRC. Available pack sizes: 100mg.
2,2-dioxo-3-phenacyl-1H-2lambda6,1,3-benzothiadiazin-4-one (CAS 40467-23-0) is a chemical compound with the molecular formula C15H12N2O4S and a molecular weight of 316.3 g/mol. IUPAC name: 2,2-dioxo-3-phenacyl-1H-2lambda6,1,3-benzothiadiazin-4-one. InChIKey: XZWQIXIWIFWYJL-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O4S |
|---|---|
| Molecular weight | 316.3 g/mol |
| IUPAC name | 2,2-dioxo-3-phenacyl-1H-2lambda6,1,3-benzothiadiazin-4-one |
| InChIKey | XZWQIXIWIFWYJL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CN2C(=O)C3=CC=CC=C3NS2(=O)=O |
Computed by PubChem (NCBI)