Products 361158-21-6
CAS 361158-21-6 is the registry number for Methyl 3-(furan-2-ylmethyl)-4-oxo-2-sulfanyl-3,4-dihydroquinazoline-7-carboxylate. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
Methyl 3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxylate (CAS 361158-21-6) is a chemical compound with the molecular formula C15H12N2O4S and a molecular weight of 316.3 g/mol. IUPAC name: methyl 3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxylate. InChIKey: CYEPVQZSQSVMCC-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O4S |
|---|---|
| Molecular weight | 316.3 g/mol |
| IUPAC name | methyl 3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxylate |
| InChIKey | CYEPVQZSQSVMCC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C(=O)N(C(=S)N2)CC3=CC=CO3 |
Computed by PubChem (NCBI)