Products 1211016-69-1
CAS 1211016-69-1 is the registry number for 1-(2-Chloroethyl)-3-(7-nitro-1,1,3,3,6-pentamethylindan-5-yl)urea, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(2-chloroethyl)-3-(1,1,3,3,6-pentamethyl-7-nitro-2H-inden-5-yl)urea (CAS 1211016-69-1) is a chemical compound with the molecular formula C17H24ClN3O3 and a molecular weight of 353.8 g/mol. IUPAC name: 1-(2-chloroethyl)-3-(1,1,3,3,6-pentamethyl-7-nitro-2H-inden-5-yl)urea. InChIKey: PIGHMOOMWDTEGX-UHFFFAOYSA-N.
| Molecular formula | C17H24ClN3O3 |
|---|---|
| Molecular weight | 353.8 g/mol |
| IUPAC name | 1-(2-chloroethyl)-3-(1,1,3,3,6-pentamethyl-7-nitro-2H-inden-5-yl)urea |
| InChIKey | PIGHMOOMWDTEGX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C2C(=C1[N+](=O)[O-])C(CC2(C)C)(C)C)NC(=O)NCCCl |
Computed by PubChem (NCBI)