Products 2796343-85-4
CAS 2796343-85-4 is the registry number for tert-Butyl 2-chloro-8-morpholino-7,8-dihydro-1,6-naphthyridine-6(5H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-chloro-8-morpholin-4-yl-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate (CAS 2796343-85-4) is a chemical compound with the molecular formula C17H24ClN3O3 and a molecular weight of 353.8 g/mol. IUPAC name: tert-butyl 2-chloro-8-morpholin-4-yl-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate. InChIKey: NBOFGABSFFWWFX-UHFFFAOYSA-N.
| Molecular formula | C17H24ClN3O3 |
|---|---|
| Molecular weight | 353.8 g/mol |
| IUPAC name | tert-butyl 2-chloro-8-morpholin-4-yl-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate |
| InChIKey | NBOFGABSFFWWFX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C2=C(C1)C=CC(=N2)Cl)N3CCOCC3 |
Computed by PubChem (NCBI)