Products 1353958-32-3
CAS 1353958-32-3 appears in our catalog under these names: 3-[(2-Chloro-pyridine-3-carbonyl)-methyl-amino]-piperidine-1-carboxylic acid tert-butyl ester, 95%, tert-Butyl 3-(2-chloro-N-methylnicotinamido)piperidine-1-carboxylate, 95%, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl 3-[(2-chloropyridine-3-carbonyl)-methylamino]piperidine-1-carboxylate (CAS 1353958-32-3) is a chemical compound with the molecular formula C17H24ClN3O3 and a molecular weight of 353.8 g/mol. IUPAC name: tert-butyl 3-[(2-chloropyridine-3-carbonyl)-methylamino]piperidine-1-carboxylate. InChIKey: LZHQBIGHGJXNDZ-UHFFFAOYSA-N.
| Molecular formula | C17H24ClN3O3 |
|---|---|
| Molecular weight | 353.8 g/mol |
| IUPAC name | tert-butyl 3-[(2-chloropyridine-3-carbonyl)-methylamino]piperidine-1-carboxylate |
| InChIKey | LZHQBIGHGJXNDZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)N(C)C(=O)C2=C(N=CC=C2)Cl |
Computed by PubChem (NCBI)