Products 121107-83-3

CAS 121107-83-3 is the registry number for TCBT 80, Concentration: 10.0 µg/ml Solvent: Isooctane. Offered by: HPC Standards. Available pack sizes: 1x5ml.

Structural formula: {0} (CAS {1})

1,2-dichloro-4-[(2,6-dichlorophenyl)methyl]-5-methylbenzene (CAS 121107-83-3) is a chemical compound with the molecular formula C14H10Cl4 and a molecular weight of 320.0 g/mol. IUPAC name: 1,2-dichloro-4-[(2,6-dichlorophenyl)methyl]-5-methylbenzene. InChIKey: LTFCIVVNQPWJNC-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10Cl4
Molecular weight320.0 g/mol
IUPAC name1,2-dichloro-4-[(2,6-dichlorophenyl)methyl]-5-methylbenzene
InChIKeyLTFCIVVNQPWJNC-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1CC2=C(C=CC=C2Cl)Cl)Cl)Cl

Computed by PubChem (NCBI)