CAS 121107-90-2 is the registry number for TCBT 87, Concentration: 10.0 µg/ml Solvent: Isooctane. Offered by: HPC Standards. Available pack sizes: 1x5ml.
1,2-dichloro-4-[(3,4-dichlorophenyl)methyl]-3-methylbenzene (CAS 121107-90-2) is a chemical compound with the molecular formula C14H10Cl4 and a molecular weight of 320.0 g/mol. IUPAC name: 1,2-dichloro-4-[(3,4-dichlorophenyl)methyl]-3-methylbenzene. InChIKey: LHSUSKLPEZBINL-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl4 |
|---|---|
| Molecular weight | 320.0 g/mol |
| IUPAC name | 1,2-dichloro-4-[(3,4-dichlorophenyl)methyl]-3-methylbenzene |
| InChIKey | LHSUSKLPEZBINL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1Cl)Cl)CC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)