CAS 1211292-52-2 is the registry number for 5-(((4-Fluorophenyl)sulfonyl)methyl)-3-methyl-1,2,4-oxadiazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[(4-fluorophenyl)sulfonylmethyl]-3-methyl-1,2,4-oxadiazole (CAS 1211292-52-2) is a chemical compound with the molecular formula C10H9FN2O3S and a molecular weight of 256.26 g/mol. IUPAC name: 5-[(4-fluorophenyl)sulfonylmethyl]-3-methyl-1,2,4-oxadiazole. InChIKey: PLVCAAHEXJPKIP-UHFFFAOYSA-N.
| Molecular formula | C10H9FN2O3S |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | 5-[(4-fluorophenyl)sulfonylmethyl]-3-methyl-1,2,4-oxadiazole |
| InChIKey | PLVCAAHEXJPKIP-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=N1)CS(=O)(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)