CAS 877977-29-2 appears in our catalog under these names: 2-(2-Oxoquinoxalin-1(2h)-yl)ethanesulfonyl fluoride, 95%, 2-(2-Oxoquinoxalin-1(2H)-yl)ethane-1-sulfonyl fluoride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-(2-oxoquinoxalin-1-yl)ethanesulfonyl fluoride (CAS 877977-29-2) is a chemical compound with the molecular formula C10H9FN2O3S and a molecular weight of 256.26 g/mol. IUPAC name: 2-(2-oxoquinoxalin-1-yl)ethanesulfonyl fluoride. InChIKey: DJQQQUGFNDIGQG-UHFFFAOYSA-N.
| Molecular formula | C10H9FN2O3S |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | 2-(2-oxoquinoxalin-1-yl)ethanesulfonyl fluoride |
| InChIKey | DJQQQUGFNDIGQG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=CC(=O)N2CCS(=O)(=O)F |
Computed by PubChem (NCBI)