CAS 885528-94-9 is the registry number for 2-(4-Oxo-3,4-dihydroquinazolin-3-yl)ethane-1-sulfonyl fluoride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(4-oxoquinazolin-3-yl)ethanesulfonyl fluoride (CAS 885528-94-9) is a chemical compound with the molecular formula C10H9FN2O3S and a molecular weight of 256.26 g/mol. IUPAC name: 2-(4-oxoquinazolin-3-yl)ethanesulfonyl fluoride. InChIKey: UPXFUDMPGUKCKT-UHFFFAOYSA-N.
| Molecular formula | C10H9FN2O3S |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | 2-(4-oxoquinazolin-3-yl)ethanesulfonyl fluoride |
| InChIKey | UPXFUDMPGUKCKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C=N2)CCS(=O)(=O)F |
Computed by PubChem (NCBI)