CAS 1211364-66-7 is the registry number for 3-Chloroimidazo[1,2-a]pyridine-6-carbohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-chloroimidazo[1,2-a]pyridine-6-carbohydrazide (CAS 1211364-66-7) is a chemical compound with the molecular formula C8H7ClN4O and a molecular weight of 210.62 g/mol. IUPAC name: 3-chloroimidazo[1,2-a]pyridine-6-carbohydrazide. InChIKey: URNNEHJKPWJSIJ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN4O |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | 3-chloroimidazo[1,2-a]pyridine-6-carbohydrazide |
| InChIKey | URNNEHJKPWJSIJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(N2C=C1C(=O)NN)Cl |
Computed by PubChem (NCBI)