CAS 2138003-96-8 is the registry number for 6-Chloro-1-(prop-2-en-1-yl)-1H,4H,5H-pyrazolo(3,4-d)pyrimidin-4-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-chloro-1-prop-2-enyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (CAS 2138003-96-8) is a chemical compound with the molecular formula C8H7ClN4O and a molecular weight of 210.62 g/mol. IUPAC name: 6-chloro-1-prop-2-enyl-5H-pyrazolo[5,4-d]pyrimidin-4-one. InChIKey: HLXPBAQJWMMEBE-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN4O |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | 6-chloro-1-prop-2-enyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | HLXPBAQJWMMEBE-UHFFFAOYSA-N |
| SMILES | C=CCN1C2=C(C=N1)C(=O)NC(=N2)Cl |
Computed by PubChem (NCBI)