CAS 143745-30-6 is the registry number for 2,6-Diamino-5-chloro-3,4-dihydroquinazolin-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2,6-diamino-5-chloro-3H-quinazolin-4-one (CAS 143745-30-6) is a chemical compound with the molecular formula C8H7ClN4O and a molecular weight of 210.62 g/mol. IUPAC name: 2,6-diamino-5-chloro-3H-quinazolin-4-one. InChIKey: NBZYJPVWAIGHSG-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN4O |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | 2,6-diamino-5-chloro-3H-quinazolin-4-one |
| InChIKey | NBZYJPVWAIGHSG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1N)Cl)C(=O)NC(=N2)N |
Computed by PubChem (NCBI)