Products 1211379-56-4
CAS 1211379-56-4 appears in our catalog under these names: INF 195, INF 195, INF 195, 99.58%, INF 195, 95%. Offered by: TargetMol, GLPBio, MedChemExpress, Ambeed, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 100 mg, 25 mg, 5 mg.
Ethyl 1-[3-(2-chlorophenyl)propanoyl]piperidine-3-carboxylate (CAS 1211379-56-4) is a chemical compound with the molecular formula C17H22ClNO3 and a molecular weight of 323.8 g/mol. IUPAC name: ethyl 1-[3-(2-chlorophenyl)propanoyl]piperidine-3-carboxylate. InChIKey: GYNZAFIFTANTDS-UHFFFAOYSA-N.
| Molecular formula | C17H22ClNO3 |
|---|---|
| Molecular weight | 323.8 g/mol |
| IUPAC name | ethyl 1-[3-(2-chlorophenyl)propanoyl]piperidine-3-carboxylate |
| InChIKey | GYNZAFIFTANTDS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCCN(C1)C(=O)CCC2=CC=CC=C2Cl |
Computed by PubChem (NCBI)