CAS 912768-88-8 is the registry number for tert-butyl 4-(3-chlorobenzoyl)piperidine-1-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-(3-chlorobenzoyl)piperidine-1-carboxylate (CAS 912768-88-8) is a chemical compound with the molecular formula C17H22ClNO3 and a molecular weight of 323.8 g/mol. IUPAC name: tert-butyl 4-(3-chlorobenzoyl)piperidine-1-carboxylate. InChIKey: BBHFUMRYWZDUMA-UHFFFAOYSA-N.
| Molecular formula | C17H22ClNO3 |
|---|---|
| Molecular weight | 323.8 g/mol |
| IUPAC name | tert-butyl 4-(3-chlorobenzoyl)piperidine-1-carboxylate |
| InChIKey | BBHFUMRYWZDUMA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C(=O)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)