Products 2626989-34-0
CAS 2626989-34-0 is the registry number for tert-Butyl 6-chloro-3H-spiro[benzofuran-2,4'-piperidine]-1'-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 6-chlorospiro[3H-1-benzofuran-2,4'-piperidine]-1'-carboxylate (CAS 2626989-34-0) is a chemical compound with the molecular formula C17H22ClNO3 and a molecular weight of 323.8 g/mol. IUPAC name: tert-butyl 6-chlorospiro[3H-1-benzofuran-2,4'-piperidine]-1'-carboxylate. InChIKey: VAIIJYZOBWVGGE-UHFFFAOYSA-N.
| Molecular formula | C17H22ClNO3 |
|---|---|
| Molecular weight | 323.8 g/mol |
| IUPAC name | tert-butyl 6-chlorospiro[3H-1-benzofuran-2,4'-piperidine]-1'-carboxylate |
| InChIKey | VAIIJYZOBWVGGE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC3=C(O2)C=C(C=C3)Cl |
Computed by PubChem (NCBI)