CAS 1211448-61-1 is the registry number for N-Boc-4-(4-pyridinyl)-L-phenylalanine, 95%. Offered by: AmBeed. Available pack sizes: 100mg, 1g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-pyridin-4-ylphenyl)propanoic acid (CAS 1211448-61-1) is a chemical compound with the molecular formula C19H22N2O4 and a molecular weight of 342.4 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-pyridin-4-ylphenyl)propanoic acid. InChIKey: ICJDVZADCKWIAR-INIZCTEOSA-N.
| Molecular formula | C19H22N2O4 |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-pyridin-4-ylphenyl)propanoic acid |
| InChIKey | ICJDVZADCKWIAR-INIZCTEOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)C2=CC=NC=C2)C(=O)O |
Computed by PubChem (NCBI)