Products 1951438-95-1

CAS 1951438-95-1 is the registry number for 6-(Aminomethyl)-6,11-dihydro-5h-dibenz(be) azpine succinate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Butanedioic acid;6,11-dihydro-5H-benzo[c][1]benzazepin-6-ylmethanamine (CAS 1951438-95-1) is a chemical compound with the molecular formula C19H22N2O4 and a molecular weight of 342.4 g/mol. IUPAC name: butanedioic acid;6,11-dihydro-5H-benzo[c][1]benzazepin-6-ylmethanamine. InChIKey: OVJXWKGCDVQOFH-UHFFFAOYSA-N.

Identity
Molecular formulaC19H22N2O4
Molecular weight342.4 g/mol
IUPAC namebutanedioic acid;6,11-dihydro-5H-benzo[c][1]benzazepin-6-ylmethanamine
InChIKeyOVJXWKGCDVQOFH-UHFFFAOYSA-N
SMILESC1C2=CC=CC=C2C(NC3=CC=CC=C31)CN.C(CC(=O)O)C(=O)O

Computed by PubChem (NCBI)