Products 721916-24-1
CAS 721916-24-1 is the registry number for 2-(4-[(Hydroxyimino)methyl]-2-methoxyphenoxy)-n-mesitylacetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[4-[(E)-hydroxyiminomethyl]-2-methoxyphenoxy]-N-(2,4,6-trimethylphenyl)acetamide (CAS 721916-24-1) is a chemical compound with the molecular formula C19H22N2O4 and a molecular weight of 342.4 g/mol. IUPAC name: 2-[4-[(E)-hydroxyiminomethyl]-2-methoxyphenoxy]-N-(2,4,6-trimethylphenyl)acetamide. InChIKey: YNRQMMJCNDHBTJ-KEBDBYFISA-N.
| Molecular formula | C19H22N2O4 |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | 2-[4-[(E)-hydroxyiminomethyl]-2-methoxyphenoxy]-N-(2,4,6-trimethylphenyl)acetamide |
| InChIKey | YNRQMMJCNDHBTJ-KEBDBYFISA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NC(=O)COC2=C(C=C(C=C2)/C=N/O)OC)C |
Computed by PubChem (NCBI)