Products 1211515-92-2

CAS 1211515-92-2 is the registry number for 2-Formyl-6-methylisonicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-formyl-6-methylpyridine-4-carboxylic acid (CAS 1211515-92-2) is a chemical compound with the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. IUPAC name: 2-formyl-6-methylpyridine-4-carboxylic acid. InChIKey: DKDZZCDBSAPPCJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7NO3
Molecular weight165.15 g/mol
IUPAC name2-formyl-6-methylpyridine-4-carboxylic acid
InChIKeyDKDZZCDBSAPPCJ-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=N1)C=O)C(=O)O

Computed by PubChem (NCBI)