CAS 1211520-86-3 is the registry number for 6-(Trifluoromethyl)-3H-(1,2,3)triazolo(4,5-b)pyridine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
6-(trifluoromethyl)-2H-triazolo[4,5-b]pyridine (CAS 1211520-86-3) is a chemical compound with the molecular formula C6H3F3N4 and a molecular weight of 188.11 g/mol. IUPAC name: 6-(trifluoromethyl)-2H-triazolo[4,5-b]pyridine. InChIKey: JUPFWTVYSFXESU-UHFFFAOYSA-N.
| Molecular formula | C6H3F3N4 |
|---|---|
| Molecular weight | 188.11 g/mol |
| IUPAC name | 6-(trifluoromethyl)-2H-triazolo[4,5-b]pyridine |
| InChIKey | JUPFWTVYSFXESU-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=NNN=C21)C(F)(F)F |
Computed by PubChem (NCBI)