CAS 486460-20-2 appears in our catalog under these names: 3-(Trifluoromethyl)-(1,2,4)triazolo(4,3-a)pyrazine, 97%, 3-(Trifluoromethyl)-(1,2,4)triazolo(4,3-a)pyrazine, 3–(Trifluoromethyl)–(1,2,4)triazolo(4,3–a)pyrazine, 3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyrazine, ≥97%, ≥97%, 3-(Trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyrazine, 97%(LC-MS),RG. Offered by: AmBeed, Mikromol, TRC, GLPBio, Chemat. Available pack sizes: 5g, 25mg, 100mg, 1g, 250mg, 50mg.
3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyrazine (CAS 486460-20-2) is a chemical compound with the molecular formula C6H3F3N4 and a molecular weight of 188.11 g/mol. IUPAC name: 3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyrazine. InChIKey: HHRYGAGDPASJQP-UHFFFAOYSA-N.
| Molecular formula | C6H3F3N4 |
|---|---|
| Molecular weight | 188.11 g/mol |
| IUPAC name | 3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyrazine |
| InChIKey | HHRYGAGDPASJQP-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NN=C2C(F)(F)F)C=N1 |
Computed by PubChem (NCBI)