CAS 681249-56-9 appears in our catalog under these names: 2–(Trifluoromethyl)–(1,2,4)triazolo(1,5–a)pyrazine, 2-(Trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrazine, 95+%, 95+%, 2-(Trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrazine, 97%, 2-(Trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrazine, 95+%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrazine (CAS 681249-56-9) is a chemical compound with the molecular formula C6H3F3N4 and a molecular weight of 188.11 g/mol. IUPAC name: 2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrazine. InChIKey: PODZNIVAQJSKBB-UHFFFAOYSA-N.
| Molecular formula | C6H3F3N4 |
|---|---|
| Molecular weight | 188.11 g/mol |
| IUPAC name | 2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrazine |
| InChIKey | PODZNIVAQJSKBB-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC(=N2)C(F)(F)F)C=N1 |
Computed by PubChem (NCBI)