CAS 1211525-80-2 is the registry number for 2-(5-Bromopyridin-2-yl)morpholine, 98%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
2-(5-bromo-2-pyridinyl)morpholine (CAS 1211525-80-2) is a chemical compound with the molecular formula C9H11BrN2O and a molecular weight of 243.10 g/mol. IUPAC name: 2-(5-bromo-2-pyridinyl)morpholine. InChIKey: RZIWBGHCXXIWNP-UHFFFAOYSA-N.
| Molecular formula | C9H11BrN2O |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 2-(5-bromo-2-pyridinyl)morpholine |
| InChIKey | RZIWBGHCXXIWNP-UHFFFAOYSA-N |
| SMILES | C1COC(CN1)C2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)