CAS 1211526-53-2 appears in our catalog under these names: 2-Azaspiro(3.3)heptane-2,6-dicarboxylic acid 2-tert-butyl ester, 2-(tert-Butoxycarbonyl)-2-azaspiro[3.3]heptane-6-carboxylic acid, 98.0%, 2-(tert-Butoxycarbonyl)-2-azaspiro[3.3]heptane-6-carboxylic acid, 95%, 2-(tert-Butoxycarbonyl)-2-azaspiro[3.3]heptane-6-carboxylic acid, 97%, 97%, 2-[(tert-butoxy)carbonyl]-2-azaspiro[3.3]heptane-6-carboxylic acid, 97%. Offered by: Biosynth, MedChemExpress, Fluorochem, Chemat, Ambeed. Available pack sizes: 5g, 2g, 10g, 50 mg, 250 mg, 100 mg, 10 g, 5 g.
2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azaspiro[3.3]heptane-6-carboxylic acid (CAS 1211526-53-2) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azaspiro[3.3]heptane-6-carboxylic acid. InChIKey: SZAAHQWPPBNUQR-UHFFFAOYSA-N.
| Molecular formula | C12H19NO4 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azaspiro[3.3]heptane-6-carboxylic acid |
| InChIKey | SZAAHQWPPBNUQR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC(C2)C(=O)O |
Computed by PubChem (NCBI)