CAS 1211529-07-5 appears in our catalog under these names: 2,6-Dichloro-[1,3]oxazolo[4,5-b]pyridine, 95%, 2,6-dichloro-(1,3)oxazolo(4,5-b)pyridine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
2,6-dichloro-[1,3]oxazolo[4,5-b]pyridine (CAS 1211529-07-5) is a chemical compound with the molecular formula C6H2Cl2N2O and a molecular weight of 189.00 g/mol. IUPAC name: 2,6-dichloro-[1,3]oxazolo[4,5-b]pyridine. InChIKey: UXHZPPFUUBFDIP-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2N2O |
|---|---|
| Molecular weight | 189.00 g/mol |
| IUPAC name | 2,6-dichloro-[1,3]oxazolo[4,5-b]pyridine |
| InChIKey | UXHZPPFUUBFDIP-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1OC(=N2)Cl)Cl |
Computed by PubChem (NCBI)