CAS 1352901-40-6 is the registry number for 2,5-Dichlorooxazolo[4,5-b]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,5-dichloro-[1,3]oxazolo[4,5-b]pyridine (CAS 1352901-40-6) is a chemical compound with the molecular formula C6H2Cl2N2O and a molecular weight of 189.00 g/mol. IUPAC name: 2,5-dichloro-[1,3]oxazolo[4,5-b]pyridine. InChIKey: AQOJXSNKUOPJTJ-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2N2O |
|---|---|
| Molecular weight | 189.00 g/mol |
| IUPAC name | 2,5-dichloro-[1,3]oxazolo[4,5-b]pyridine |
| InChIKey | AQOJXSNKUOPJTJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1OC(=N2)Cl)Cl |
Computed by PubChem (NCBI)