CAS 178747-91-6 is the registry number for 3,5-Dichloroisoxazolo[5,4-b]pyridine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3,5-dichloro-[1,2]oxazolo[5,4-b]pyridine (CAS 178747-91-6) is a chemical compound with the molecular formula C6H2Cl2N2O and a molecular weight of 189.00 g/mol. IUPAC name: 3,5-dichloro-[1,2]oxazolo[5,4-b]pyridine. InChIKey: WCCWXWZNNRZIEY-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2N2O |
|---|---|
| Molecular weight | 189.00 g/mol |
| IUPAC name | 3,5-dichloro-[1,2]oxazolo[5,4-b]pyridine |
| InChIKey | WCCWXWZNNRZIEY-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1C(=NO2)Cl)Cl |
Computed by PubChem (NCBI)