CAS 1211534-67-6 is the registry number for 5-Methoxy-2-methyl-3-nitropyridine, 96%. Offered by: AmBeed. Available pack sizes: 5g.
5-methoxy-2-methyl-3-nitropyridine (CAS 1211534-67-6) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 5-methoxy-2-methyl-3-nitropyridine. InChIKey: LDDPXKWMHPTTOT-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 5-methoxy-2-methyl-3-nitropyridine |
| InChIKey | LDDPXKWMHPTTOT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=N1)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)