Products 1211535-95-3
CAS 1211535-95-3 appears in our catalog under these names: 5-(Trifluoromethyl)pyridazine-3-carboxylic acid, 95%, 95%, 5-(TRIFLUOROMETHYL)PYRIDAZINE-3-CARBOXYLIC ACID, 95%, 5-(Trifluoromethyl)pyridazine-3-carboxylic acid. Offered by: Chemat, Fluorochem, Ambeed, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 2,5g.
5-(trifluoromethyl)pyridazine-3-carboxylic acid (CAS 1211535-95-3) is a chemical compound with the molecular formula C6H3F3N2O2 and a molecular weight of 192.10 g/mol. IUPAC name: 5-(trifluoromethyl)pyridazine-3-carboxylic acid. InChIKey: OWVCAVCZOSBFBJ-UHFFFAOYSA-N.
| Molecular formula | C6H3F3N2O2 |
|---|---|
| Molecular weight | 192.10 g/mol |
| IUPAC name | 5-(trifluoromethyl)pyridazine-3-carboxylic acid |
| InChIKey | OWVCAVCZOSBFBJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NN=C1C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)