Products 1211536-10-5
CAS 1211536-10-5 is the registry number for 2-Bromo-6-methoxy-4-(trifluoromethyl)pyridine, 98+%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-bromo-6-methoxy-4-(trifluoromethyl)pyridine (CAS 1211536-10-5) is a chemical compound with the molecular formula C7H5BrF3NO and a molecular weight of 256.02 g/mol. IUPAC name: 2-bromo-6-methoxy-4-(trifluoromethyl)pyridine. InChIKey: WWHUBKGOVIRGBI-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF3NO |
|---|---|
| Molecular weight | 256.02 g/mol |
| IUPAC name | 2-bromo-6-methoxy-4-(trifluoromethyl)pyridine |
| InChIKey | WWHUBKGOVIRGBI-UHFFFAOYSA-N |
| SMILES | COC1=NC(=CC(=C1)C(F)(F)F)Br |
Computed by PubChem (NCBI)