CAS 1211588-96-3 appears in our catalog under these names: 5-Bromo-2-iodo-1-(phenylsulfonyl)-1h-pyrrolo[2,3-b]pyridine, 95%, 5-Bromo-2-iodo-1-(phenylsulfonyl)-1H-pyrrolo(2,3-b)pyridine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
1-(benzenesulfonyl)-5-bromo-2-iodopyrrolo[2,3-b]pyridine (CAS 1211588-96-3) is a chemical compound with the molecular formula C13H8BrIN2O2S and a molecular weight of 463.09 g/mol. IUPAC name: 1-(benzenesulfonyl)-5-bromo-2-iodopyrrolo[2,3-b]pyridine. InChIKey: NUUJOBJNGUELLL-UHFFFAOYSA-N.
| Molecular formula | C13H8BrIN2O2S |
|---|---|
| Molecular weight | 463.09 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-5-bromo-2-iodopyrrolo[2,3-b]pyridine |
| InChIKey | NUUJOBJNGUELLL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C(=CC3=CC(=CN=C32)Br)I |
Computed by PubChem (NCBI)