CAS 1638772-30-1 is the registry number for 1h-pyrrolo[2,3-c]pyridine, 3-iodo-1-[(4-bromophenyl)sulfonyl]-, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-bromophenyl)sulfonyl-3-iodopyrrolo[2,3-c]pyridine (CAS 1638772-30-1) is a chemical compound with the molecular formula C13H8BrIN2O2S and a molecular weight of 463.09 g/mol. IUPAC name: 1-(4-bromophenyl)sulfonyl-3-iodopyrrolo[2,3-c]pyridine. InChIKey: WZTJIXWWEXXEFV-UHFFFAOYSA-N.
| Molecular formula | C13H8BrIN2O2S |
|---|---|
| Molecular weight | 463.09 g/mol |
| IUPAC name | 1-(4-bromophenyl)sulfonyl-3-iodopyrrolo[2,3-c]pyridine |
| InChIKey | WZTJIXWWEXXEFV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)N2C=C(C3=C2C=NC=C3)I)Br |
Computed by PubChem (NCBI)