CAS 889939-26-8 appears in our catalog under these names: 4–Bromo–2–iodo–1–(phenylsulfonyl)–1H–pyrrolo(2,3–b)pyridine, 4-Bromo-2-iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine, ≥97%, ≥97%, 1-Benzenesulfonyl-4-bromo-2-iodo-7-azaindole, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
1-(benzenesulfonyl)-4-bromo-2-iodopyrrolo[2,3-b]pyridine (CAS 889939-26-8) is a chemical compound with the molecular formula C13H8BrIN2O2S and a molecular weight of 463.09 g/mol. IUPAC name: 1-(benzenesulfonyl)-4-bromo-2-iodopyrrolo[2,3-b]pyridine. InChIKey: JVCKOYFZXMUSEY-UHFFFAOYSA-N.
| Molecular formula | C13H8BrIN2O2S |
|---|---|
| Molecular weight | 463.09 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-4-bromo-2-iodopyrrolo[2,3-b]pyridine |
| InChIKey | JVCKOYFZXMUSEY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C(=CC3=C(C=CN=C32)Br)I |
Computed by PubChem (NCBI)