Products 1211589-19-3
CAS 1211589-19-3 is the registry number for 5-Chloro-6-cyanonicotinicAcid, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
5-chloro-6-cyanopyridine-3-carboxylic acid (CAS 1211589-19-3) is a chemical compound with the molecular formula C7H3ClN2O2 and a molecular weight of 182.56 g/mol. IUPAC name: 5-chloro-6-cyanopyridine-3-carboxylic acid. InChIKey: FXJGOCIGSJIXDE-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O2 |
|---|---|
| Molecular weight | 182.56 g/mol |
| IUPAC name | 5-chloro-6-cyanopyridine-3-carboxylic acid |
| InChIKey | FXJGOCIGSJIXDE-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)C#N)C(=O)O |
Computed by PubChem (NCBI)