Products 1211589-36-4
CAS 1211589-36-4 is the registry number for Methyl 4-methyl-6-(trifluoromethyl)-3-pyridinecarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 4-methyl-6-(trifluoromethyl)pyridine-3-carboxylate (CAS 1211589-36-4) is a chemical compound with the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. IUPAC name: methyl 4-methyl-6-(trifluoromethyl)pyridine-3-carboxylate. InChIKey: IWUYTAOVWSBSAN-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO2 |
|---|---|
| Molecular weight | 219.16 g/mol |
| IUPAC name | methyl 4-methyl-6-(trifluoromethyl)pyridine-3-carboxylate |
| InChIKey | IWUYTAOVWSBSAN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1C(=O)OC)C(F)(F)F |
Computed by PubChem (NCBI)