CAS 1211593-67-7 is the registry number for 1-(3,5-Dimethoxyphenyl)cyclopropanamine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(3,5-dimethoxyphenyl)cyclopropan-1-amine (CAS 1211593-67-7) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: 1-(3,5-dimethoxyphenyl)cyclopropan-1-amine. InChIKey: JKLSQESFRNWDBC-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 1-(3,5-dimethoxyphenyl)cyclopropan-1-amine |
| InChIKey | JKLSQESFRNWDBC-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C2(CC2)N)OC |
Computed by PubChem (NCBI)