CAS 1211594-23-8 is the registry number for 5-Fluoro-2,3-dihydrospiro[indene-1,2'-pyrrolidine], 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
6-fluorospiro[1,2-dihydroindene-3,2'-pyrrolidine] (CAS 1211594-23-8) is a chemical compound with the molecular formula C12H14FN and a molecular weight of 191.24 g/mol. IUPAC name: 6-fluorospiro[1,2-dihydroindene-3,2'-pyrrolidine]. InChIKey: MCQVKKSUGHTDKI-UHFFFAOYSA-N.
| Molecular formula | C12H14FN |
|---|---|
| Molecular weight | 191.24 g/mol |
| IUPAC name | 6-fluorospiro[1,2-dihydroindene-3,2'-pyrrolidine] |
| InChIKey | MCQVKKSUGHTDKI-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC3=C2C=CC(=C3)F)NC1 |
Computed by PubChem (NCBI)