CAS 2140879-92-9 is the registry number for 8-Fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-amine, 98%. Offered by: AmBeed. Available pack sizes: 1g.
8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-amine (CAS 2140879-92-9) is a chemical compound with the molecular formula C12H14FN and a molecular weight of 191.24 g/mol. IUPAC name: 8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-amine. InChIKey: PMOAFDBPQNDDTA-UHFFFAOYSA-N.
| Molecular formula | C12H14FN |
|---|---|
| Molecular weight | 191.24 g/mol |
| IUPAC name | 8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-amine |
| InChIKey | PMOAFDBPQNDDTA-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C(=C3CCCC3=C2N)F |
Computed by PubChem (NCBI)