Products 491601-36-6
CAS 491601-36-6 is the registry number for 6-Fluoro-2-isobutyl-1H-indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g, 25g.
6-fluoro-2-(2-methylpropyl)-1H-indole (CAS 491601-36-6) is a chemical compound with the molecular formula C12H14FN and a molecular weight of 191.24 g/mol. IUPAC name: 6-fluoro-2-(2-methylpropyl)-1H-indole. InChIKey: LRQGQNUCAOYDFU-UHFFFAOYSA-N.
| Molecular formula | C12H14FN |
|---|---|
| Molecular weight | 191.24 g/mol |
| IUPAC name | 6-fluoro-2-(2-methylpropyl)-1H-indole |
| InChIKey | LRQGQNUCAOYDFU-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC2=C(N1)C=C(C=C2)F |
Computed by PubChem (NCBI)